C19H26O3 — CID 14442756
methyl 1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate (PubChem CID 14442756) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is methyl 1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate.
| Compound Name | methyl 1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 14442756 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl 1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate |
| SMILES | COC(=O)C1(C)CCC2C(CCC3=CC(=O)C=CC32C)C1C |
| InChI | InChI=1S/C19H26O3/c1-12-15-6-5-13-11-14(20)7-9-19(13,3)16(15)8-10-18(12,2)17(21)22-4/h7,9,11-12,15-16H,5-6,8,10H2,1-4H3 |
| InChIKey | BOQHVHAJWGPUDE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |