C18H24O3 — CID 14442758
1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid (PubChem CID 14442758) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid.
| Compound Name | 1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 14442758 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1,2,4b-trimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylic acid |
| SMILES | CC1C2CCC3=CC(=O)C=CC3(C)C2CCC1(C)C(=O)O |
| InChI | InChI=1S/C18H24O3/c1-11-14-5-4-12-10-13(19)6-8-18(12,3)15(14)7-9-17(11,2)16(20)21/h6,8,10-11,14-15H,4-5,7,9H2,1-3H3,(H,20,21) |
| InChIKey | YQCXFQRUVLISPY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |