C18H24O3 — CID 14442760
methyl 2,4b-dimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate (PubChem CID 14442760) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is methyl 2,4b-dimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate.
| Compound Name | methyl 2,4b-dimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 14442760 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | methyl 2,4b-dimethyl-7-oxo-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate |
| SMILES | COC(=O)C1(C)CCC2C(CCC3=CC(=O)C=CC32C)C1 |
| InChI | InChI=1S/C18H24O3/c1-17(16(20)21-3)8-7-15-12(11-17)4-5-13-10-14(19)6-9-18(13,15)2/h6,9-10,12,15H,4-5,7-8,11H2,1-3H3 |
| InChIKey | JFPRTDXRHXOBRN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |