C14H18O3 — CID 14443156
8-ethyl-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione (PubChem CID 14443156) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 8-ethyl-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione.
| Compound Name | 8-ethyl-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione |
|---|---|
| PubChem CID | 14443156 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 8-ethyl-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione |
| SMILES | CCC1(C)C(=O)CCc2c1oc(C)c(C)c2=O |
| InChI | InChI=1S/C14H18O3/c1-5-14(4)11(15)7-6-10-12(16)8(2)9(3)17-13(10)14/h5-7H2,1-4H3 |
| InChIKey | DMWYENNLKSWREM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |