C8H11N3O4 — CID 14443627
4-amino-1-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 14443627) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 14443627 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2OC[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H11N3O4/c9-5-1-2-11(8(14)10-5)7-6(13)4(12)3-15-7/h1-2,4,6-7,12-13H,3H2,(H2,9,10,14)/t4-,6-,7-/m1/s1 |
| InChIKey | RPXKLKGKUUDJFW-QPPQHZFASA-N |
| XLogP | -1.92 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |