About 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane
2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane (PubChem CID 14443721) has the molecular formula C17H26O4S
and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane.
Molecular Properties
| Compound Name | 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane |
| PubChem CID | 14443721 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane |
| SMILES | CC(CS(=O)(=O)c1ccccc1)C(C)(C)OC1CCCCO1 |
| InChI | InChI=1S/C17H26O4S/c1-14(13-22(18,19)15-9-5-4-6-10-15)17(2,3)21-16-11-7-8-12-20-16/h4-6,9-10,14,16H,7-8,11-13H2,1-3H3 |
| InChIKey | BXLVDRBXXXGMES-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane?
The IUPAC name of 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane (CID 14443721) is 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane.
What is the SMILES notation for 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane?
The canonical SMILES for 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane is CC(CS(=O)(=O)c1ccccc1)C(C)(C)OC1CCCCO1.
What is the InChIKey of 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane?
The InChIKey is BXLVDRBXXXGMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4S/c1-14(13-22(18,19)15-9-5-4-6-10-15)17(2,3)21-16-11-7-8-12-20-16/h4-6,9-10,14,16H,7-8,11-13H2,1-3H3.
What are the key properties of 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane?
2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane has a molecular weight of 326.46 g/mol, XLogP of 3.42, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane is sourced from PubChem (CID 14443721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).