C12H18O4 — CID 14445080
ethyl 2-[(1S,3Z,7S)-8,10-dioxabicyclo[5.2.1]dec-3-en-7-yl]acetate (PubChem CID 14445080) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is ethyl 2-[(1S,3Z,7S)-8,10-dioxabicyclo[5.2.1]dec-3-en-7-yl]acetate.
| Compound Name | ethyl 2-[(1S,3Z,7S)-8,10-dioxabicyclo[5.2.1]dec-3-en-7-yl]acetate |
|---|---|
| PubChem CID | 14445080 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | ethyl 2-[(1S,3Z,7S)-8,10-dioxabicyclo[5.2.1]dec-3-en-7-yl]acetate |
| SMILES | CCOC(=O)C[C@@]12CC/C=C\C[C@@H](CO1)O2 |
| InChI | InChI=1S/C12H18O4/c1-2-14-11(13)8-12-7-5-3-4-6-10(16-12)9-15-12/h3-4,10H,2,5-9H2,1H3/b4-3-/t10-,12-/m0/s1 |
| InChIKey | PTHNBCGWBAUXPN-BCEXGZMNSA-N |
| XLogP | 1.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|