C28H42O7 — CID 14445348
methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-3-hydroxyoct-1-en-5-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 14445348) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-3-hydroxyoct-1-en-5-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-3-hydroxyoct-1-en-5-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 14445348 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-3-hydroxyoct-1-en-5-ynyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCC#CCC(O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C28H42O7/c1-4-5-8-13-22(30)17-18-24-23(14-9-6-7-10-15-27(31)32-3)25(34-21(2)29)20-26(24)35-28-16-11-12-19-33-28/h6,9,17-18,22-26,28,30H,4,7,10-16,19-20H2,1-3H3/b9-6-,18-17+/t22?,23-,24-,25+,26-,28?/m1/s1 |
| InChIKey | AGVCZKSCKWFZKY-DQTPNDNCSA-N |
| XLogP | 4.48 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|