C16H23F3O2 — CID 144457143
(3Z,7R,8E,12Z)-7-methoxy-3-methyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene (PubChem CID 144457143) has the molecular formula C16H23F3O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3Z,7R,8E,12Z)-7-methoxy-3-methyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene.
| Compound Name | (3Z,7R,8E,12Z)-7-methoxy-3-methyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene |
|---|---|
| PubChem CID | 144457143 |
| Molecular Formula | C16H23F3O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (3Z,7R,8E,12Z)-7-methoxy-3-methyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-triene |
| SMILES | C/C/1=C/CC[C@H](/C=C/CC/C(=C/COC1)/C(F)(F)F)OC |
| InChI | InChI=1S/C16H23F3O2/c1-13-6-5-9-15(20-2)8-4-3-7-14(16(17,18)19)10-11-21-12-13/h4,6,8,10,15H,3,5,7,9,11-12H2,1-2H3/b8-4+,13-6-,14-10-/t15-/m0/s1 |
| InChIKey | PUHVQWMOYDOQLF-VUCZEJLWSA-N |
| XLogP | 3.20 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | 395 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|