About 6-benzylpiperazine-2,3,5-trione
6-benzylpiperazine-2,3,5-trione (PubChem CID 14446168) has the molecular formula C11H10N2O3
and a molecular weight of 218.21 g/mol. Its IUPAC name is 6-benzylpiperazine-2,3,5-trione.
Molecular Properties
| Compound Name | 6-benzylpiperazine-2,3,5-trione |
| PubChem CID | 14446168 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 6-benzylpiperazine-2,3,5-trione |
| SMILES | O=C1NC(=O)C(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C11H10N2O3/c14-9-8(12-10(15)11(16)13-9)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,12,15)(H,13,14,16) |
| InChIKey | WKSROKPAPSNRAH-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-benzylpiperazine-2,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylpiperazine-2,3,5-trione?
The IUPAC name of 6-benzylpiperazine-2,3,5-trione (CID 14446168) is 6-benzylpiperazine-2,3,5-trione.
What is the SMILES notation for 6-benzylpiperazine-2,3,5-trione?
The canonical SMILES for 6-benzylpiperazine-2,3,5-trione is O=C1NC(=O)C(Cc2ccccc2)NC1=O.
What is the InChIKey of 6-benzylpiperazine-2,3,5-trione?
The InChIKey is WKSROKPAPSNRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c14-9-8(12-10(15)11(16)13-9)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,12,15)(H,13,14,16).
What are the key properties of 6-benzylpiperazine-2,3,5-trione?
6-benzylpiperazine-2,3,5-trione has a molecular weight of 218.21 g/mol, XLogP of -0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylpiperazine-2,3,5-trione is sourced from PubChem (CID 14446168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).