C24H34O8 — CID 14446310
[(1S,2R,4S,7R,9R,11R,12S)-11-acetyloxy-2-(acetyloxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] 3-methylbutanoate (PubChem CID 14446310) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1S,2R,4S,7R,9R,11R,12S)-11-acetyloxy-2-(acetyloxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] 3-methylbutanoate.
| Compound Name | [(1S,2R,4S,7R,9R,11R,12S)-11-acetyloxy-2-(acetyloxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 14446310 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1S,2R,4S,7R,9R,11R,12S)-11-acetyloxy-2-(acetyloxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] 3-methylbutanoate |
| SMILES | CC(=O)OC[C@]12C[C@H](OC(=O)CC(C)C)C(C)=C[C@H]1O[C@@H]1C[C@@H](OC(C)=O)[C@@]2(C)[C@]12CO2 |
| InChI | InChI=1S/C24H34O8/c1-13(2)7-21(27)31-17-10-23(11-28-15(4)25)19(8-14(17)3)32-20-9-18(30-16(5)26)22(23,6)24(20)12-29-24/h8,13,17-20H,7,9-12H2,1-6H3/t17-,18+,19+,20+,22+,23+,24-/m0/s1 |
| InChIKey | YQRLXMTYNHLULK-VUQJFAEZSA-N |
| XLogP | 2.72 |
| TPSA | 100.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|