C13H20O4 — CID 14446774
6-[(E,6R)-6-hydroxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 14446774) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-[(E,6R)-6-hydroxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(E,6R)-6-hydroxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 14446774 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-[(E,6R)-6-hydroxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C[C@@H](O)CCC/C=C/C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C13H20O4/c1-10(14)7-5-4-6-8-11-9-12(15)17-13(2,3)16-11/h6,8-10,14H,4-5,7H2,1-3H3/b8-6+/t10-/m1/s1 |
| InChIKey | JPXNKVAGZKQYPD-QEHWCHDUSA-N |
| XLogP | 2.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|