C17H25BrINO — CID 14447092
1-[(2-bromophenoxy)methyl]-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium iodide (PubChem CID 14447092) has the molecular formula C17H25BrINO and a molecular weight of 466.20 g/mol. Its IUPAC name is 1-[(2-bromophenoxy)methyl]-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium iodide.
| Compound Name | 1-[(2-bromophenoxy)methyl]-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium iodide |
|---|---|
| PubChem CID | 14447092 |
| Molecular Formula | C17H25BrINO |
| Molecular Weight | 466.20 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 1-[(2-bromophenoxy)methyl]-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium iodide |
| SMILES | C[N+]12CCCCC1C(COc1ccccc1Br)CCC2.[I-] |
| InChI | InChI=1S/C17H25BrNO.HI/c1-19-11-5-4-9-16(19)14(7-6-12-19)13-20-17-10-3-2-8-15(17)18;/h2-3,8,10,14,16H,4-7,9,11-13H2,1H3;1H/q+1;/p-1 |
| InChIKey | IBNJAPNLJQYWDU-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|