C17H24O3 — CID 14448075
(4aS,8aR,9aS)-9a-ethoxy-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran-2-one (PubChem CID 14448075) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (4aS,8aR,9aS)-9a-ethoxy-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (4aS,8aR,9aS)-9a-ethoxy-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 14448075 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (4aS,8aR,9aS)-9a-ethoxy-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@]3(OCC)OC(=O)C(C)=C3C[C@@H]12 |
| InChI | InChI=1S/C17H24O3/c1-5-19-17-10-16(4)8-6-7-11(2)13(16)9-14(17)12(3)15(18)20-17/h13H,2,5-10H2,1,3-4H3/t13-,16+,17-/m0/s1 |
| InChIKey | JATCNILBQFTWFJ-XKQJLSEDSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|