methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate

C12H20O4 — CID 14448249

IUPACmethyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate
SMILESCOC(=O)CC1(CCC=C(C)C)OCCO1
InChIInChI=1S/C12H20O4/c1-10(2)5-4-6-12(9-11(13)14-3)15-7-8-16-12/h5H,4,6-9H2,1-3H3
InChIKeyUGVAYLTWKDXLRD-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.04
Rot. Bonds5

About methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate

methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate (PubChem CID 14448249) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate
PubChem CID14448249
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Namemethyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate
SMILESCOC(=O)CC1(CCC=C(C)C)OCCO1
InChIInChI=1S/C12H20O4/c1-10(2)5-4-6-12(9-11(13)14-3)15-7-8-16-12/h5H,4,6-9H2,1-3H3
InChIKeyUGVAYLTWKDXLRD-UHFFFAOYSA-N
XLogP2.04
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate?
The IUPAC name of methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate (CID 14448249) is methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate.
What is the SMILES notation for methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate?
The canonical SMILES for methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate is COC(=O)CC1(CCC=C(C)C)OCCO1.
What is the InChIKey of methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate?
The InChIKey is UGVAYLTWKDXLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-10(2)5-4-6-12(9-11(13)14-3)15-7-8-16-12/h5H,4,6-9H2,1-3H3.
What are the key properties of methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate?
methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate has a molecular weight of 228.29 g/mol, XLogP of 2.04, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(4-methylpent-3-enyl)-1,3-dioxolan-2-yl]acetate is sourced from PubChem (CID 14448249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).