About 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol
1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol (PubChem CID 14448483) has the molecular formula C17H35NO
and a molecular weight of 269.47 g/mol. Its IUPAC name is 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol.
Molecular Properties
| Compound Name | 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol |
| PubChem CID | 14448483 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol |
| SMILES | CCCCCCCCCC(O)C[C@H]1CCC[C@H](C)N1 |
| InChI | InChI=1S/C17H35NO/c1-3-4-5-6-7-8-9-13-17(19)14-16-12-10-11-15(2)18-16/h15-19H,3-14H2,1-2H3/t15-,16+,17?/m0/s1 |
| InChIKey | JTNNKRMOHRFVLZ-RTKIROINSA-N |
| XLogP | 4.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol?
The IUPAC name of 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol (CID 14448483) is 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol.
What is the SMILES notation for 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol?
The canonical SMILES for 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol is CCCCCCCCCC(O)C[C@H]1CCC[C@H](C)N1.
What is the InChIKey of 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol?
The InChIKey is JTNNKRMOHRFVLZ-RTKIROINSA-N. The full InChI is InChI=1S/C17H35NO/c1-3-4-5-6-7-8-9-13-17(19)14-16-12-10-11-15(2)18-16/h15-19H,3-14H2,1-2H3/t15-,16+,17?/m0/s1.
What are the key properties of 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol?
1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol has a molecular weight of 269.47 g/mol, XLogP of 4.41, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,6S)-6-methylpiperidin-2-yl]undecan-2-ol is sourced from PubChem (CID 14448483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).