About 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine
2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine (PubChem CID 14448586) has the molecular formula C7H13N5
and a molecular weight of 167.22 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine.
Analyze 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine?
The IUPAC name of 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine (CID 14448586) is 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine.
What is the SMILES notation for 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine?
The canonical SMILES for 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine is CN(C)c1ncnc(N(C)C)n1.
What is the InChIKey of 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine?
The InChIKey is WVAVNHQRAYFCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5/c1-11(2)6-8-5-9-7(10-6)12(3)4/h5H,1-4H3.
What are the key properties of 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine?
2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine has a molecular weight of 167.22 g/mol, XLogP of 0.00, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine is sourced from PubChem (CID 14448586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).