About 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran
5-(thian-2-yl)-3,4-dihydro-2H-thiopyran (PubChem CID 14448769) has the molecular formula C10H16S2
and a molecular weight of 200.37 g/mol. Its IUPAC name is 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran |
| PubChem CID | 14448769 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran |
| SMILES | C1=C(C2CCCCS2)CCCS1 |
| InChI | InChI=1S/C10H16S2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h8,10H,1-7H2 |
| InChIKey | MZCUTLNVAHXTBD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran?
The IUPAC name of 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran (CID 14448769) is 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran.
What is the SMILES notation for 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran?
The canonical SMILES for 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran is C1=C(C2CCCCS2)CCCS1.
What is the InChIKey of 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran?
The InChIKey is MZCUTLNVAHXTBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h8,10H,1-7H2.
What are the key properties of 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran?
5-(thian-2-yl)-3,4-dihydro-2H-thiopyran has a molecular weight of 200.37 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thian-2-yl)-3,4-dihydro-2H-thiopyran is sourced from PubChem (CID 14448769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).