About 2,5-difluoropyrimidine
2,5-difluoropyrimidine (PubChem CID 14449398) has the molecular formula C4H2F2N2
and a molecular weight of 116.07 g/mol. Its IUPAC name is 2,5-difluoropyrimidine.
Molecular Properties
| Compound Name | 2,5-difluoropyrimidine |
| PubChem CID | 14449398 |
| Molecular Formula | C4H2F2N2 |
| Molecular Weight | 116.07 g/mol |
| Exact Mass | 116.02 |
| IUPAC Name | 2,5-difluoropyrimidine |
| SMILES | Fc1cnc(F)nc1 |
| InChI | InChI=1S/C4H2F2N2/c5-3-1-7-4(6)8-2-3/h1-2H |
| InChIKey | XQZRVVFDGQSMLS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.07 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-difluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoropyrimidine?
The IUPAC name of 2,5-difluoropyrimidine (CID 14449398) is 2,5-difluoropyrimidine.
What is the SMILES notation for 2,5-difluoropyrimidine?
The canonical SMILES for 2,5-difluoropyrimidine is Fc1cnc(F)nc1.
What is the InChIKey of 2,5-difluoropyrimidine?
The InChIKey is XQZRVVFDGQSMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F2N2/c5-3-1-7-4(6)8-2-3/h1-2H.
What are the key properties of 2,5-difluoropyrimidine?
2,5-difluoropyrimidine has a molecular weight of 116.07 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoropyrimidine is sourced from PubChem (CID 14449398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).