C19H19F17Si — CID 144499075
Methyl-bis(prop-2-enyl)-[6,7,7,7-tetrafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-bis(trifluoromethyl)hept-4-enyl]silane (PubChem CID 144499075) has the molecular formula C19H19F17Si and a molecular weight of 598.40 g/mol. Its IUPAC name is methyl-bis(prop-2-enyl)-[6,7,7,7-tetrafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-bis(trifluoromethyl)hept-4-enyl]silane.
| Compound Name | Methyl-bis(prop-2-enyl)-[6,7,7,7-tetrafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-bis(trifluoromethyl)hept-4-enyl]silane |
|---|---|
| PubChem CID | 144499075 |
| Molecular Formula | C19H19F17Si |
| Molecular Weight | 598.40 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | methyl-bis(prop-2-enyl)-[6,7,7,7-tetrafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-bis(trifluoromethyl)hept-4-enyl]silane |
| SMILES | C[Si](CCCC(=C(C(C(F)(F)F)(C(F)(F)F)F)C(C(F)(F)F)(C(F)(F)F)F)C(F)(F)F)(CC=C)CC=C |
| InChI | InChI=1S/C19H19F17Si/c1-4-8-37(3,9-5-2)10-6-7-11(15(22,23)24)12(13(20,16(25,26)27)17(28,29)30)14(21,18(31,32)33)19(34,35)36/h4-5H,1-2,6-10H2,3H3 |
| InChIKey | QMLVZXXLHDJVTC-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | 757 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|