C21H28N4OS — CID 144500129
4-(ethylideneamino)-N-(4-methoxy-3-pyridinyl)-5-methyl-1,3-benzothiazol-2-amine;pentane (PubChem CID 144500129) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 4-(ethylideneamino)-N-(4-methoxy-3-pyridinyl)-5-methyl-1,3-benzothiazol-2-amine;pentane.
| Compound Name | 4-(ethylideneamino)-N-(4-methoxy-3-pyridinyl)-5-methyl-1,3-benzothiazol-2-amine;pentane |
|---|---|
| PubChem CID | 144500129 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-(ethylideneamino)-N-(4-methoxy-3-pyridinyl)-5-methyl-1,3-benzothiazol-2-amine;pentane |
| SMILES | C/C=N/c1c(C)ccc2sc(Nc3cnccc3OC)nc12.CCCCC |
| InChI | InChI=1S/C16H16N4OS.C5H12/c1-4-18-14-10(2)5-6-13-15(14)20-16(22-13)19-11-9-17-8-7-12(11)21-3;1-3-5-4-2/h4-9H,1-3H3,(H,19,20);3-5H2,1-2H3/b18-4+; |
| InChIKey | IURGMTUCZGYOLL-BLSWVXOOSA-N |
| XLogP | 6.67 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|