About 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate
8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate (PubChem CID 144500134) has the molecular formula C12H17FO6
and a molecular weight of 276.26 g/mol. Its IUPAC name is 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate.
Molecular Properties
| Compound Name | 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate |
| PubChem CID | 144500134 |
| Molecular Formula | C12H17FO6 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OF)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H17FO6/c1-2-16-9(14)11(10(15)19-13)3-5-12(6-4-11)17-7-8-18-12/h2-8H2,1H3 |
| InChIKey | LVMRKNHMGWMXQN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate?
The IUPAC name of 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate (CID 144500134) is 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate.
What is the SMILES notation for 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate?
The canonical SMILES for 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate is CCOC(=O)C1(C(=O)OF)CCC2(CC1)OCCO2.
What is the InChIKey of 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate?
The InChIKey is LVMRKNHMGWMXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FO6/c1-2-16-9(14)11(10(15)19-13)3-5-12(6-4-11)17-7-8-18-12/h2-8H2,1H3.
What are the key properties of 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate?
8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate has a molecular weight of 276.26 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-O-ethyl 8-O'-fluoro 1,4-dioxaspiro[4.5]decane-8,8-dicarboxylate is sourced from PubChem (CID 144500134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).