C11H12N2O2 — CID 144500148
7-ethenyl-6,8-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 144500148) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 7-ethenyl-6,8-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-ethenyl-6,8-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 144500148 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 7-ethenyl-6,8-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | C=Cc1c(C)nc2c(c1C)OCC(=O)N2 |
| InChI | InChI=1S/C11H12N2O2/c1-4-8-6(2)10-11(12-7(8)3)13-9(14)5-15-10/h4H,1,5H2,2-3H3,(H,12,13,14) |
| InChIKey | ZZHWVCOASKWPEX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |