C24H25F2N3 — CID 144500535
6-(2,3-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane (PubChem CID 144500535) has the molecular formula C24H25F2N3 and a molecular weight of 393.48 g/mol. Its IUPAC name is 6-(2,3-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane.
| Compound Name | 6-(2,3-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane |
|---|---|
| PubChem CID | 144500535 |
| Molecular Formula | C24H25F2N3 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 6-(2,3-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane |
| SMILES | C=C/C(=C\C=C/C)c1nc(N)c2cc(-c3cccc(F)c3F)ccc2n1.CCC |
| InChI | InChI=1S/C21H17F2N3.C3H8/c1-3-5-7-13(4-2)21-25-18-11-10-14(12-16(18)20(24)26-21)15-8-6-9-17(22)19(15)23;1-3-2/h3-12H,2H2,1H3,(H2,24,25,26);3H2,1-2H3/b5-3-,13-7+; |
| InChIKey | XVLYRLNEYLCBNW-AZJNDVGQSA-N |
| XLogP | 6.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|