C15H17F2N — CID 144500551
(2Z,4E)-5-(3,4-difluorophenyl)-N,3-dimethylhepta-2,4,6-trien-2-amine (PubChem CID 144500551) has the molecular formula C15H17F2N and a molecular weight of 249.30 g/mol. Its IUPAC name is (2Z,4E)-5-(3,4-difluorophenyl)-N,3-dimethylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4E)-5-(3,4-difluorophenyl)-N,3-dimethylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 144500551 |
| Molecular Formula | C15H17F2N |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (2Z,4E)-5-(3,4-difluorophenyl)-N,3-dimethylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C(C)=C(\C)NC)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H17F2N/c1-5-12(8-10(2)11(3)18-4)13-6-7-14(16)15(17)9-13/h5-9,18H,1H2,2-4H3/b11-10-,12-8+ |
| InChIKey | OEHXRMZQILOGRS-WROCRQLKSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|