C24H23N3 — CID 144500657
(2E,4Z)-N'-[4-(4-cyanophenyl)-2,5-dimethylphenyl]-2-ethenyl-N-methylidenehexa-2,4-dienimidamide (PubChem CID 144500657) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is (2E,4Z)-N'-[4-(4-cyanophenyl)-2,5-dimethylphenyl]-2-ethenyl-N-methylidenehexa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-N'-[4-(4-cyanophenyl)-2,5-dimethylphenyl]-2-ethenyl-N-methylidenehexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 144500657 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (2E,4Z)-N'-[4-(4-cyanophenyl)-2,5-dimethylphenyl]-2-ethenyl-N-methylidenehexa-2,4-dienimidamide |
| SMILES | C=CC(=C\C=C/C)/C(N=C)=N/c1cc(C)c(-c2ccc(C#N)cc2)cc1C |
| InChI | InChI=1S/C24H23N3/c1-6-8-9-20(7-2)24(26-5)27-23-15-17(3)22(14-18(23)4)21-12-10-19(16-25)11-13-21/h6-15H,2,5H2,1,3-4H3/b8-6-,20-9+,27-24- |
| InChIKey | JVZUXOSPULGIOO-CMHODSKFSA-N |
| XLogP | 6.26 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|