C17H20F3NO — CID 144500728
(2E,4E,6Z)-5-(2,3-difluorophenyl)-3-(2-fluoroethoxy)-N-methylocta-2,4,6-trien-2-amine (PubChem CID 144500728) has the molecular formula C17H20F3NO and a molecular weight of 311.35 g/mol. Its IUPAC name is (2E,4E,6Z)-5-(2,3-difluorophenyl)-3-(2-fluoroethoxy)-N-methylocta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E,6Z)-5-(2,3-difluorophenyl)-3-(2-fluoroethoxy)-N-methylocta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 144500728 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (2E,4E,6Z)-5-(2,3-difluorophenyl)-3-(2-fluoroethoxy)-N-methylocta-2,4,6-trien-2-amine |
| SMILES | C/C=C\C(=C/C(OCCF)=C(/C)NC)c1cccc(F)c1F |
| InChI | InChI=1S/C17H20F3NO/c1-4-6-13(14-7-5-8-15(19)17(14)20)11-16(12(2)21-3)22-10-9-18/h4-8,11,21H,9-10H2,1-3H3/b6-4-,13-11+,16-12+ |
| InChIKey | GCAMASTVLAZNDM-QATUSMSCSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|