C24H23N3O — CID 144500959
1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-6-yl]phenyl]ethanone (PubChem CID 144500959) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-6-yl]phenyl]ethanone.
| Compound Name | 1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-6-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 144500959 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-6-yl]phenyl]ethanone |
| SMILES | C=C/C(=C\C=C/C)c1nc(NC)c2cc(-c3ccc(C(C)=O)cc3)ccc2n1 |
| InChI | InChI=1S/C24H23N3O/c1-5-7-8-17(6-2)23-26-22-14-13-20(15-21(22)24(25-4)27-23)19-11-9-18(10-12-19)16(3)28/h5-15H,2H2,1,3-4H3,(H,25,26,27)/b7-5-,17-8+ |
| InChIKey | ZTGZNZZNTJODKM-DJZAMEBTSA-N |
| XLogP | 5.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|