C26H31N3O2 — CID 144501058
6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine;ethane (PubChem CID 144501058) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine;ethane.
| Compound Name | 6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 144501058 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine;ethane |
| SMILES | C=C/C(=C\C=C/C)c1nc(NC)c2cc(-c3cccc(OC)c3OC)ccc2n1.CC |
| InChI | InChI=1S/C24H25N3O2.C2H6/c1-6-8-10-16(7-2)23-26-20-14-13-17(15-19(20)24(25-3)27-23)18-11-9-12-21(28-4)22(18)29-5;1-2/h6-15H,2H2,1,3-5H3,(H,25,26,27);1-2H3/b8-6-,16-10+; |
| InChIKey | WDFFKELAAHYKRA-IDMJAFQXSA-N |
| XLogP | 6.53 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|