C24H25N3O2 — CID 144501059
6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine (PubChem CID 144501059) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine.
| Compound Name | 6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 144501059 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 6-(2,3-dimethoxyphenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine |
| SMILES | C=C/C(=C\C=C/C)c1nc(NC)c2cc(-c3cccc(OC)c3OC)ccc2n1 |
| InChI | InChI=1S/C24H25N3O2/c1-6-8-10-16(7-2)23-26-20-14-13-17(15-19(20)24(25-3)27-23)18-11-9-12-21(28-4)22(18)29-5/h6-15H,2H2,1,3-5H3,(H,25,26,27)/b8-6-,16-10+ |
| InChIKey | KQIGEPJVXQSODN-YTRFMEJKSA-N |
| XLogP | 5.50 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|