C20H28FNO — CID 144501248
(2E,4E,6Z)-N-ethyl-5-(2-fluorophenyl)-3-(2-methylpropoxy)octa-2,4,6-trien-2-amine (PubChem CID 144501248) has the molecular formula C20H28FNO and a molecular weight of 317.45 g/mol. Its IUPAC name is (2E,4E,6Z)-N-ethyl-5-(2-fluorophenyl)-3-(2-methylpropoxy)octa-2,4,6-trien-2-amine.
| Compound Name | (2E,4E,6Z)-N-ethyl-5-(2-fluorophenyl)-3-(2-methylpropoxy)octa-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 144501248 |
| Molecular Formula | C20H28FNO |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (2E,4E,6Z)-N-ethyl-5-(2-fluorophenyl)-3-(2-methylpropoxy)octa-2,4,6-trien-2-amine |
| SMILES | C/C=C\C(=C/C(OCC(C)C)=C(/C)NCC)c1ccccc1F |
| InChI | InChI=1S/C20H28FNO/c1-6-10-17(18-11-8-9-12-19(18)21)13-20(16(5)22-7-2)23-14-15(3)4/h6,8-13,15,22H,7,14H2,1-5H3/b10-6-,17-13+,20-16+ |
| InChIKey | DOPSHBMSRRFQIV-KXMVVMEHSA-N |
| XLogP | 5.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|