C30H27F4N3 — CID 144501391
N-(3,4-difluorophenyl)-7-(3,5-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane (PubChem CID 144501391) has the molecular formula C30H27F4N3 and a molecular weight of 505.56 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-7-(3,5-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane.
| Compound Name | N-(3,4-difluorophenyl)-7-(3,5-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane |
|---|---|
| PubChem CID | 144501391 |
| Molecular Formula | C30H27F4N3 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-(3,4-difluorophenyl)-7-(3,5-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]quinazolin-4-amine;propane |
| SMILES | C=C/C(=C\C=C/C)c1nc(Nc2ccc(F)c(F)c2)c2ccc(-c3cc(F)cc(F)c3)cc2n1.CCC |
| InChI | InChI=1S/C27H19F4N3.C3H8/c1-3-5-6-16(4-2)26-33-25-13-17(18-11-19(28)14-20(29)12-18)7-9-22(25)27(34-26)32-21-8-10-23(30)24(31)15-21;1-3-2/h3-15H,2H2,1H3,(H,32,33,34);3H2,1-2H3/b5-3-,16-6+; |
| InChIKey | JRTRBWQQPYUYLR-DDLPENQBSA-N |
| XLogP | 9.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|