C23H20N4 — CID 144501453
2-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-7-yl]benzonitrile (PubChem CID 144501453) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-7-yl]benzonitrile.
| Compound Name | 2-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 144501453 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(methylamino)quinazolin-7-yl]benzonitrile |
| SMILES | C=C/C(=C\C=C/C)c1nc(NC)c2ccc(-c3ccccc3C#N)cc2n1 |
| InChI | InChI=1S/C23H20N4/c1-4-6-9-16(5-2)22-26-21-14-17(12-13-20(21)23(25-3)27-22)19-11-8-7-10-18(19)15-24/h4-14H,2H2,1,3H3,(H,25,26,27)/b6-4-,16-9+ |
| InChIKey | RBFPHYXCEIRJRN-MWPQJANJSA-N |
| XLogP | 5.36 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|