C34H36FN — CID 144501458
N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-1-[5-(3-fluorophenyl)-2-methylphenyl]-2-(4-methyl-2-propylphenyl)ethanimine (PubChem CID 144501458) has the molecular formula C34H36FN and a molecular weight of 477.67 g/mol. Its IUPAC name is N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-1-[5-(3-fluorophenyl)-2-methylphenyl]-2-(4-methyl-2-propylphenyl)ethanimine.
| Compound Name | N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-1-[5-(3-fluorophenyl)-2-methylphenyl]-2-(4-methyl-2-propylphenyl)ethanimine |
|---|---|
| PubChem CID | 144501458 |
| Molecular Formula | C34H36FN |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-1-[5-(3-fluorophenyl)-2-methylphenyl]-2-(4-methyl-2-propylphenyl)ethanimine |
| SMILES | C=C/C(=C\C=C/C)C(=C)/N=C(/Cc1ccc(C)cc1CCC)c1cc(-c2cccc(F)c2)ccc1C |
| InChI | InChI=1S/C34H36FN/c1-7-10-13-27(9-3)26(6)36-34(23-31-18-16-24(4)20-28(31)12-8-2)33-22-30(19-17-25(33)5)29-14-11-15-32(35)21-29/h7,9-11,13-22H,3,6,8,12,23H2,1-2,4-5H3/b10-7-,27-13+,36-34- |
| InChIKey | YBXAXGBWAWSGJW-VMMAVBFZSA-N |
| XLogP | 9.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|