C11H16N2P2 — CID 144501748
2-(2-methyl-1H-indol-3-yl)-N,N-bis(phosphanyl)ethanamine (PubChem CID 144501748) has the molecular formula C11H16N2P2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-N,N-bis(phosphanyl)ethanamine.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-N,N-bis(phosphanyl)ethanamine |
|---|---|
| PubChem CID | 144501748 |
| Molecular Formula | C11H16N2P2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-N,N-bis(phosphanyl)ethanamine |
| SMILES | Cc1[nH]c2ccccc2c1CCN(P)P |
| InChI | InChI=1S/C11H16N2P2/c1-8-9(6-7-13(14)15)10-4-2-3-5-11(10)12-8/h2-5,12H,6-7,14-15H2,1H3 |
| InChIKey | SAWWFKNTNCYNEV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|