About 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol
3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol (PubChem CID 144501999) has the molecular formula C13H17F4NO
and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol.
Molecular Properties
| Compound Name | 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol |
| PubChem CID | 144501999 |
| Molecular Formula | C13H17F4NO |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol |
| SMILES | CO.FC1CCN(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H13F4N.CH4O/c13-11-4-5-17(8-11)7-9-2-1-3-10(6-9)12(14,15)16;1-2/h1-3,6,11H,4-5,7-8H2;2H,1H3 |
| InChIKey | HGGLUFKOTGYDGU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol?
The IUPAC name of 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol (CID 144501999) is 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol.
What is the SMILES notation for 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol?
The canonical SMILES for 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol is CO.FC1CCN(Cc2cccc(C(F)(F)F)c2)C1.
What is the InChIKey of 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol?
The InChIKey is HGGLUFKOTGYDGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F4N.CH4O/c13-11-4-5-17(8-11)7-9-2-1-3-10(6-9)12(14,15)16;1-2/h1-3,6,11H,4-5,7-8H2;2H,1H3.
What are the key properties of 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol?
3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol has a molecular weight of 279.28 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;methanol is sourced from PubChem (CID 144501999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).