About methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine
methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine (PubChem CID 144502021) has the molecular formula C14H20F3NO
and a molecular weight of 275.31 g/mol. Its IUPAC name is methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine.
Molecular Properties
| Compound Name | methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine |
| PubChem CID | 144502021 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine |
| SMILES | CC1CCCN1Cc1cccc(C(F)(F)F)c1.CO |
| InChI | InChI=1S/C13H16F3N.CH4O/c1-10-4-3-7-17(10)9-11-5-2-6-12(8-11)13(14,15)16;1-2/h2,5-6,8,10H,3-4,7,9H2,1H3;2H,1H3 |
| InChIKey | DZMMLHXJFGHTDB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine?
The IUPAC name of methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine (CID 144502021) is methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine.
What is the SMILES notation for methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine?
The canonical SMILES for methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine is CC1CCCN1Cc1cccc(C(F)(F)F)c1.CO.
What is the InChIKey of methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine?
The InChIKey is DZMMLHXJFGHTDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N.CH4O/c1-10-4-3-7-17(10)9-11-5-2-6-12(8-11)13(14,15)16;1-2/h2,5-6,8,10H,3-4,7,9H2,1H3;2H,1H3.
What are the key properties of methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine?
methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine has a molecular weight of 275.31 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine is sourced from PubChem (CID 144502021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).