C20H12F3I3O — CID 144502130
2,3-diiodo-1-[3-iodo-4-[4-(trifluoromethoxy)phenyl]phenyl]-4-methylbenzene (PubChem CID 144502130) has the molecular formula C20H12F3I3O and a molecular weight of 706.02 g/mol. Its IUPAC name is 2,3-diiodo-1-[3-iodo-4-[4-(trifluoromethoxy)phenyl]phenyl]-4-methylbenzene.
| Compound Name | 2,3-diiodo-1-[3-iodo-4-[4-(trifluoromethoxy)phenyl]phenyl]-4-methylbenzene |
|---|---|
| PubChem CID | 144502130 |
| Molecular Formula | C20H12F3I3O |
| Molecular Weight | 706.02 g/mol |
| Exact Mass | 705.80 |
| IUPAC Name | 2,3-diiodo-1-[3-iodo-4-[4-(trifluoromethoxy)phenyl]phenyl]-4-methylbenzene |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(OC(F)(F)F)cc3)c(I)c2)c(I)c1I |
| InChI | InChI=1S/C20H12F3I3O/c1-11-2-8-16(19(26)18(11)25)13-5-9-15(17(24)10-13)12-3-6-14(7-4-12)27-20(21,22)23/h2-10H,1H3 |
| InChIKey | BSBXBFFYSJMJQD-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.02 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|