About ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene
ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene (PubChem CID 144503009) has the molecular formula C19H25F
and a molecular weight of 272.41 g/mol. Its IUPAC name is ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene.
Molecular Properties
| Compound Name | ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene |
| PubChem CID | 144503009 |
| Molecular Formula | C19H25F |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene |
| SMILES | CC.Cc1ccc(-c2ccc(F)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C17H19F.C2H6/c1-10-6-7-15(12(3)11(10)2)16-8-9-17(18)14(5)13(16)4;1-2/h6-9H,1-5H3;1-2H3 |
| InChIKey | UUGRHJUHHHHRDD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene?
The IUPAC name of ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene (CID 144503009) is ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene.
What is the SMILES notation for ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene?
The canonical SMILES for ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene is CC.Cc1ccc(-c2ccc(F)c(C)c2C)c(C)c1C.
What is the InChIKey of ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene?
The InChIKey is UUGRHJUHHHHRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F.C2H6/c1-10-6-7-15(12(3)11(10)2)16-8-9-17(18)14(5)13(16)4;1-2/h6-9H,1-5H3;1-2H3.
What are the key properties of ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene?
ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene has a molecular weight of 272.41 g/mol, XLogP of 6.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-2,3-dimethyl-4-(2,3,4-trimethylphenyl)benzene is sourced from PubChem (CID 144503009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).