About N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene
N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene (PubChem CID 144503585) has the molecular formula C12H28N2
and a molecular weight of 200.37 g/mol. Its IUPAC name is N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene.
Molecular Properties
| Compound Name | N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene |
| PubChem CID | 144503585 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC.CN(C)C1CCNC1 |
| InChI | InChI=1S/C6H14N2.C4H8.C2H6/c1-8(2)6-3-4-7-5-6;1-4(2)3;1-2/h6-7H,3-5H2,1-2H3;1H2,2-3H3;1-2H3 |
| InChIKey | CZUNCQSFKKJTGQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene?
The IUPAC name of N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene (CID 144503585) is N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene.
What is the SMILES notation for N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene?
The canonical SMILES for N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene is C=C(C)C.CC.CN(C)C1CCNC1.
What is the InChIKey of N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene?
The InChIKey is CZUNCQSFKKJTGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C4H8.C2H6/c1-8(2)6-3-4-7-5-6;1-4(2)3;1-2/h6-7H,3-5H2,1-2H3;1H2,2-3H3;1-2H3.
What are the key properties of N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene?
N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene has a molecular weight of 200.37 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpyrrolidin-3-amine;ethane;2-methylprop-1-ene is sourced from PubChem (CID 144503585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).