C17H30N2 — CID 144503666
4-ethyl-N-(piperidin-4-ylmethyl)aniline;propane (PubChem CID 144503666) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-ethyl-N-(piperidin-4-ylmethyl)aniline;propane.
| Compound Name | 4-ethyl-N-(piperidin-4-ylmethyl)aniline;propane |
|---|---|
| PubChem CID | 144503666 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 4-ethyl-N-(piperidin-4-ylmethyl)aniline;propane |
| SMILES | CCC.CCc1ccc(NCC2CCNCC2)cc1 |
| InChI | InChI=1S/C14H22N2.C3H8/c1-2-12-3-5-14(6-4-12)16-11-13-7-9-15-10-8-13;1-3-2/h3-6,13,15-16H,2,7-11H2,1H3;3H2,1-2H3 |
| InChIKey | LRXWECVKKPKKDB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |