About 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol
2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol (PubChem CID 144503704) has the molecular formula C9H18F2N2S
and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol.
Molecular Properties
| Compound Name | 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol |
| PubChem CID | 144503704 |
| Molecular Formula | C9H18F2N2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol |
| SMILES | FC(F)CN1CCC(NCCS)CC1 |
| InChI | InChI=1S/C9H18F2N2S/c10-9(11)7-13-4-1-8(2-5-13)12-3-6-14/h8-9,12,14H,1-7H2 |
| InChIKey | PLOFRYMRIDPZDT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol?
The IUPAC name of 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol (CID 144503704) is 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol.
What is the SMILES notation for 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol?
The canonical SMILES for 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol is FC(F)CN1CCC(NCCS)CC1.
What is the InChIKey of 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol?
The InChIKey is PLOFRYMRIDPZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2S/c10-9(11)7-13-4-1-8(2-5-13)12-3-6-14/h8-9,12,14H,1-7H2.
What are the key properties of 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol?
2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol has a molecular weight of 224.32 g/mol, XLogP of 1.24, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethanethiol is sourced from PubChem (CID 144503704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).