C29H48OS2 — CID 144503797
8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),10-triene (PubChem CID 144503797) has the molecular formula C29H48OS2 and a molecular weight of 476.84 g/mol. Its IUPAC name is 8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),10-triene.
| Compound Name | 8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),10-triene |
|---|---|
| PubChem CID | 144503797 |
| Molecular Formula | C29H48OS2 |
| Molecular Weight | 476.84 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | 8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),10-triene |
| SMILES | CC(C)CCCC(C)CCC1(CCC(C)CCCC(C)C)OC2=C(SCC2)c2sccc21 |
| InChI | InChI=1S/C29H48OS2/c1-21(2)9-7-11-23(5)13-17-29(18-14-24(6)12-8-10-22(3)4)25-15-19-31-27(25)28-26(30-29)16-20-32-28/h15,19,21-24H,7-14,16-18,20H2,1-6H3 |
| InChIKey | AYTWHLRZYLPBQH-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.84 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |