(2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride

C7H6ClFO — CID 144504108

IUPAC(2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride
SMILESC=C/C(=C\C(=C)F)C(=O)Cl
InChIInChI=1S/C7H6ClFO/c1-3-6(7(8)10)4-5(2)9/h3-4H,1-2H2/b6-4+
InChIKeyNNMJGZKZHYMUSO-GQCTYLIASA-N
MW160.57 g/mol
LogP2.35
Rot. Bonds3

About (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride

(2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride (PubChem CID 144504108) has the molecular formula C7H6ClFO and a molecular weight of 160.57 g/mol. Its IUPAC name is (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride.

Molecular Properties

Compound Name(2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride
PubChem CID144504108
Molecular FormulaC7H6ClFO
Molecular Weight160.57 g/mol
Exact Mass160.01
IUPAC Name(2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride
SMILESC=C/C(=C\C(=C)F)C(=O)Cl
InChIInChI=1S/C7H6ClFO/c1-3-6(7(8)10)4-5(2)9/h3-4H,1-2H2/b6-4+
InChIKeyNNMJGZKZHYMUSO-GQCTYLIASA-N
XLogP2.35
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.57
LogP ≤ 52.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride?
The IUPAC name of (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride (CID 144504108) is (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride.
What is the SMILES notation for (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride?
The canonical SMILES for (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride is C=C/C(=C\C(=C)F)C(=O)Cl.
What is the InChIKey of (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride?
The InChIKey is NNMJGZKZHYMUSO-GQCTYLIASA-N. The full InChI is InChI=1S/C7H6ClFO/c1-3-6(7(8)10)4-5(2)9/h3-4H,1-2H2/b6-4+.
What are the key properties of (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride?
(2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride has a molecular weight of 160.57 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethenyl-4-fluoropenta-2,4-dienoyl chloride is sourced from PubChem (CID 144504108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).