C14H30O2 — CID 144504372
ethane;2,5,5-trimethyl-2-(3-methylbutyl)-1,3-dioxane (PubChem CID 144504372) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is ethane;2,5,5-trimethyl-2-(3-methylbutyl)-1,3-dioxane.
| Compound Name | ethane;2,5,5-trimethyl-2-(3-methylbutyl)-1,3-dioxane |
|---|---|
| PubChem CID | 144504372 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | ethane;2,5,5-trimethyl-2-(3-methylbutyl)-1,3-dioxane |
| SMILES | CC.CC(C)CCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C12H24O2.C2H6/c1-10(2)6-7-12(5)13-8-11(3,4)9-14-12;1-2/h10H,6-9H2,1-5H3;1-2H3 |
| InChIKey | VPVZMHQCTYONBM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |