About ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine
ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 144504375) has the molecular formula C13H26N4
and a molecular weight of 238.38 g/mol. Its IUPAC name is ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine |
| PubChem CID | 144504375 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | CC.CCN(C)CCN(C)Cc1ncccn1 |
| InChI | InChI=1S/C11H20N4.C2H6/c1-4-14(2)8-9-15(3)10-11-12-6-5-7-13-11;1-2/h5-7H,4,8-10H2,1-3H3;1-2H3 |
| InChIKey | VQZJNOXYGDXCGW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine?
The IUPAC name of ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine (CID 144504375) is ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine?
The canonical SMILES for ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine is CC.CCN(C)CCN(C)Cc1ncccn1.
What is the InChIKey of ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine?
The InChIKey is VQZJNOXYGDXCGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4.C2H6/c1-4-14(2)8-9-15(3)10-11-12-6-5-7-13-11;1-2/h5-7H,4,8-10H2,1-3H3;1-2H3.
What are the key properties of ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine?
ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine has a molecular weight of 238.38 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N,N'-dimethyl-N'-(pyrimidin-2-ylmethyl)ethane-1,2-diamine is sourced from PubChem (CID 144504375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).