About N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine
N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine (PubChem CID 144504530) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine |
| PubChem CID | 144504530 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine |
| SMILES | CCNCC1=CC(F)=CCC1 |
| InChI | InChI=1S/C9H14FN/c1-2-11-7-8-4-3-5-9(10)6-8/h5-6,11H,2-4,7H2,1H3 |
| InChIKey | ZZPFTHXXGOUFPY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine?
The IUPAC name of N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine (CID 144504530) is N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine.
What is the SMILES notation for N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine?
The canonical SMILES for N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine is CCNCC1=CC(F)=CCC1.
What is the InChIKey of N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine?
The InChIKey is ZZPFTHXXGOUFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-2-11-7-8-4-3-5-9(10)6-8/h5-6,11H,2-4,7H2,1H3.
What are the key properties of N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine?
N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine has a molecular weight of 155.22 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluorocyclohexa-1,3-dien-1-yl)methyl]ethanamine is sourced from PubChem (CID 144504530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).