C12H12N2O — CID 144505025
2-(1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl)acetaldehyde (PubChem CID 144505025) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-(1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl)acetaldehyde.
| Compound Name | 2-(1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 144505025 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-(1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl)acetaldehyde |
| SMILES | O=CCc1nc2cccc3c2n1CCC3 |
| InChI | InChI=1S/C12H12N2O/c15-8-6-11-13-10-5-1-3-9-4-2-7-14(11)12(9)10/h1,3,5,8H,2,4,6-7H2 |
| InChIKey | ZRBOYCFMHNOPHR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|