C29H22F3N3O3 — CID 144505055
3-[2-[2-(3,5-difluorophenyl)-1-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methoxyamino]ethyl]-3-pyridinyl]benzaldehyde (PubChem CID 144505055) has the molecular formula C29H22F3N3O3 and a molecular weight of 517.51 g/mol. Its IUPAC name is 3-[2-[2-(3,5-difluorophenyl)-1-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methoxyamino]ethyl]-3-pyridinyl]benzaldehyde.
| Compound Name | 3-[2-[2-(3,5-difluorophenyl)-1-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methoxyamino]ethyl]-3-pyridinyl]benzaldehyde |
|---|---|
| PubChem CID | 144505055 |
| Molecular Formula | C29H22F3N3O3 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 3-[2-[2-(3,5-difluorophenyl)-1-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methoxyamino]ethyl]-3-pyridinyl]benzaldehyde |
| SMILES | O=Cc1cccc(-c2cccnc2C(Cc2cc(F)cc(F)c2)NOCC2C(=O)Nc3ccc(F)cc32)c1 |
| InChI | InChI=1S/C29H22F3N3O3/c30-20-6-7-26-24(14-20)25(29(37)34-26)16-38-35-27(12-18-10-21(31)13-22(32)11-18)28-23(5-2-8-33-28)19-4-1-3-17(9-19)15-36/h1-11,13-15,25,27,35H,12,16H2,(H,34,37) |
| InChIKey | LQYRQLDHVFFUGB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|