About ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine
ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine (PubChem CID 144505337) has the molecular formula C14H19FN2
and a molecular weight of 234.32 g/mol. Its IUPAC name is ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine.
Molecular Properties
| Compound Name | ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine |
| PubChem CID | 144505337 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C(=C(/C)N=C)c1cnc(F)c(C)c1.CC |
| InChI | InChI=1S/C12H13FN2.C2H6/c1-5-11(9(3)14-4)10-6-8(2)12(13)15-7-10;1-2/h5-7H,1,4H2,2-3H3;1-2H3/b11-9+; |
| InChIKey | AFDOAAJTJRKQQK-LBEJWNQZSA-N |
| XLogP | 4.17 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine?
The IUPAC name of ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine (CID 144505337) is ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine.
What is the SMILES notation for ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine?
The canonical SMILES for ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine is C=C/C(=C(/C)N=C)c1cnc(F)c(C)c1.CC.
What is the InChIKey of ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine?
The InChIKey is AFDOAAJTJRKQQK-LBEJWNQZSA-N. The full InChI is InChI=1S/C12H13FN2.C2H6/c1-5-11(9(3)14-4)10-6-8(2)12(13)15-7-10;1-2/h5-7H,1,4H2,2-3H3;1-2H3/b11-9+;.
What are the key properties of ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine?
ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine has a molecular weight of 234.32 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(2E)-3-(6-fluoro-5-methyl-3-pyridinyl)penta-2,4-dien-2-yl]methanimine is sourced from PubChem (CID 144505337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).